CAS 349404-68-8 is the registry number for 4–Bromo–N–(3,4–dimethylphenyl)benzenesulfonamide. Offered by: GLPBio. Available pack sizes: 1g.
4-bromo-N-(3,4-dimethylphenyl)benzenesulfonamide (CAS 349404-68-8) is a chemical compound with the molecular formula C14H14BrNO2S and a molecular weight of 340.24 g/mol. IUPAC name: 4-bromo-N-(3,4-dimethylphenyl)benzenesulfonamide. InChIKey: IADFXMWVIYQRCA-UHFFFAOYSA-N.
| Molecular formula | C14H14BrNO2S |
|---|---|
| Molecular weight | 340.24 g/mol |
| IUPAC name | 4-bromo-N-(3,4-dimethylphenyl)benzenesulfonamide |
| InChIKey | IADFXMWVIYQRCA-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)NS(=O)(=O)C2=CC=C(C=C2)Br)C |
Computed by PubChem (NCBI)