CAS 330558-88-8 is the registry number for 7-(2-Chloroethyl)-3-methyl-3,7-dihydro-1H-purine-2,6-dione. Offered by: Biosynth. Available pack sizes: 5mg, 1mg, 10mg.
7-(2-chloroethyl)-3-methylpurine-2,6-dione (CAS 330558-88-8) is a chemical compound with the molecular formula C8H9ClN4O2 and a molecular weight of 228.63 g/mol. IUPAC name: 7-(2-chloroethyl)-3-methylpurine-2,6-dione. InChIKey: BVELTQAHMSSWFZ-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN4O2 |
|---|---|
| Molecular weight | 228.63 g/mol |
| IUPAC name | 7-(2-chloroethyl)-3-methylpurine-2,6-dione |
| InChIKey | BVELTQAHMSSWFZ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C(=O)NC1=O)N(C=N2)CCCl |
Computed by PubChem (NCBI)