Products 331002-74-5
CAS 331002-74-5 appears in our catalog under these names: 2-Ethoxy-4-formylphenyl 4-methylbenzoate, 95%, 2-Ethoxy-4-formylphenyl 4-methylbenzoate, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
(2-ethoxy-4-formylphenyl) 4-methylbenzoate (CAS 331002-74-5) is a chemical compound with the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. IUPAC name: (2-ethoxy-4-formylphenyl) 4-methylbenzoate. InChIKey: HDGNEDYQYJBPAQ-UHFFFAOYSA-N.
| Molecular formula | C17H16O4 |
|---|---|
| Molecular weight | 284.31 g/mol |
| IUPAC name | (2-ethoxy-4-formylphenyl) 4-methylbenzoate |
| InChIKey | HDGNEDYQYJBPAQ-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=CC(=C1)C=O)OC(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)