Products 33121-71-0

CAS 33121-71-0 appears in our catalog under these names: 2,6-Dimethylnaphthalene-1-carboxylic acid, 95%, 2,6-Dimethylnaphthalene-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.

2,6-dimethylnaphthalene-1-carboxylic acid (CAS 33121-71-0) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 2,6-dimethylnaphthalene-1-carboxylic acid. InChIKey: IWEATXLWFWACOA-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O2
Molecular weight200.23 g/mol
IUPAC name2,6-dimethylnaphthalene-1-carboxylic acid
InChIKeyIWEATXLWFWACOA-UHFFFAOYSA-N
SMILESCC1=CC2=C(C=C1)C(=C(C=C2)C)C(=O)O

Computed by PubChem (NCBI)