CAS 33121-71-0 appears in our catalog under these names: 2,6-Dimethylnaphthalene-1-carboxylic acid, 95%, 2,6-Dimethylnaphthalene-1-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2,6-dimethylnaphthalene-1-carboxylic acid (CAS 33121-71-0) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 2,6-dimethylnaphthalene-1-carboxylic acid. InChIKey: IWEATXLWFWACOA-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 2,6-dimethylnaphthalene-1-carboxylic acid |
| InChIKey | IWEATXLWFWACOA-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)C(=C(C=C2)C)C(=O)O |
Computed by PubChem (NCBI)