Products 331627-19-1
CAS 331627-19-1 is the registry number for N-(2,4-Dimethylphenyl)-5-oxopyrrolidine-2-carboxamide. Offered by: Biosynth. Available pack sizes: 10g, 1g.
N-(2,4-dimethylphenyl)-5-oxopyrrolidine-2-carboxamide (CAS 331627-19-1) is a chemical compound with the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. IUPAC name: N-(2,4-dimethylphenyl)-5-oxopyrrolidine-2-carboxamide. InChIKey: KJQVNTRVLSNHND-UHFFFAOYSA-N.
| Molecular formula | C13H16N2O2 |
|---|---|
| Molecular weight | 232.28 g/mol |
| IUPAC name | N-(2,4-dimethylphenyl)-5-oxopyrrolidine-2-carboxamide |
| InChIKey | KJQVNTRVLSNHND-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC(=O)C2CCC(=O)N2)C |
Computed by PubChem (NCBI)