Products 331821-10-4
CAS 331821-10-4 appears in our catalog under these names: 1-(5-Bromo-3-chloro-2-hydroxyphenyl)ethan-1-one, 95%, 1-(5-Bromo-3-chloro-2-hydroxyphenyl)ethan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
1-(5-bromo-3-chloro-2-hydroxyphenyl)ethanone (CAS 331821-10-4) is a chemical compound with the molecular formula C8H6BrClO2 and a molecular weight of 249.49 g/mol. IUPAC name: 1-(5-bromo-3-chloro-2-hydroxyphenyl)ethanone. InChIKey: JPNKIDWQXJZFDV-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO2 |
|---|---|
| Molecular weight | 249.49 g/mol |
| IUPAC name | 1-(5-bromo-3-chloro-2-hydroxyphenyl)ethanone |
| InChIKey | JPNKIDWQXJZFDV-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)Br)Cl)O |
Computed by PubChem (NCBI)