Products 332131-29-0

CAS 332131-29-0 is the registry number for (5-Fluoro-2-hydroxyphenyl)methyl acetate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

(5-fluoro-2-hydroxyphenyl)methyl acetate (CAS 332131-29-0) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: (5-fluoro-2-hydroxyphenyl)methyl acetate. InChIKey: FFTXVWLOPWEBEG-UHFFFAOYSA-N.

Identity
Molecular formulaC9H9FO3
Molecular weight184.16 g/mol
IUPAC name(5-fluoro-2-hydroxyphenyl)methyl acetate
InChIKeyFFTXVWLOPWEBEG-UHFFFAOYSA-N
SMILESCC(=O)OCC1=C(C=CC(=C1)F)O

Computed by PubChem (NCBI)