CAS 332131-29-0 is the registry number for (5-Fluoro-2-hydroxyphenyl)methyl acetate, 96%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 100mg.
(5-fluoro-2-hydroxyphenyl)methyl acetate (CAS 332131-29-0) is a chemical compound with the molecular formula C9H9FO3 and a molecular weight of 184.16 g/mol. IUPAC name: (5-fluoro-2-hydroxyphenyl)methyl acetate. InChIKey: FFTXVWLOPWEBEG-UHFFFAOYSA-N.
| Molecular formula | C9H9FO3 |
|---|---|
| Molecular weight | 184.16 g/mol |
| IUPAC name | (5-fluoro-2-hydroxyphenyl)methyl acetate |
| InChIKey | FFTXVWLOPWEBEG-UHFFFAOYSA-N |
| SMILES | CC(=O)OCC1=C(C=CC(=C1)F)O |
Computed by PubChem (NCBI)