CAS 33233-67-9 appears in our catalog under these names: 4-(Boc-aminomethyl)benzoic Acid, 4–(((tert–Butoxycarbonyl)amino)methyl)benzoic acid, Boc-4-Amb-OH, 4-(Boc-aminomethyl)benzoic acid, 97% , 4-[(tert-Butoxycarbonylamino)methyl]benzoic Acid, >98.0%(HPLC)(T). Offered by: TRC, GLPBio, Iris Biotech, Thermo Scientific (Alfa Aesar), TCI. Available pack sizes: 1g, 5g, 100g, 25g, 10g, 500g, 250g.
4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid (CAS 33233-67-9) is a chemical compound with the molecular formula C13H17NO4 and a molecular weight of 251.28 g/mol. IUPAC name: 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid. InChIKey: LNKHBRDWRIIROP-UHFFFAOYSA-N.
| Molecular formula | C13H17NO4 |
|---|---|
| Molecular weight | 251.28 g/mol |
| IUPAC name | 4-[[(2-methylpropan-2-yl)oxycarbonylamino]methyl]benzoic acid |
| InChIKey | LNKHBRDWRIIROP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCC1=CC=C(C=C1)C(=O)O |
Computed by PubChem (NCBI)