CAS 33234-38-7 is the registry number for 4-chloro-5-methoxy-1H-Indole-2,3-dione. Offered by: Biosynth. Available pack sizes: 100mg, 50mg, 250mg, 500mg.
4-chloro-5-methoxy-1H-indole-2,3-dione (CAS 33234-38-7) is a chemical compound with the molecular formula C9H6ClNO3 and a molecular weight of 211.60 g/mol. IUPAC name: 4-chloro-5-methoxy-1H-indole-2,3-dione. InChIKey: UAMMYAPYQZBSSZ-UHFFFAOYSA-N.
| Molecular formula | C9H6ClNO3 |
|---|---|
| Molecular weight | 211.60 g/mol |
| IUPAC name | 4-chloro-5-methoxy-1H-indole-2,3-dione |
| InChIKey | UAMMYAPYQZBSSZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C2=C(C=C1)NC(=O)C2=O)Cl |
Computed by PubChem (NCBI)