Products 860501-37-7
CAS 860501-37-7 is the registry number for 7-Chloro-2,3-dihydroquinolin-4(1h)-one hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
7-chloro-2,3-dihydro-1H-quinolin-4-one;hydrochloride (CAS 860501-37-7) is a chemical compound with the molecular formula C9H9Cl2NO and a molecular weight of 218.08 g/mol. IUPAC name: 7-chloro-2,3-dihydro-1H-quinolin-4-one;hydrochloride. InChIKey: HBXLYFQETNLICN-UHFFFAOYSA-N.
| Molecular formula | C9H9Cl2NO |
|---|---|
| Molecular weight | 218.08 g/mol |
| IUPAC name | 7-chloro-2,3-dihydro-1H-quinolin-4-one;hydrochloride |
| InChIKey | HBXLYFQETNLICN-UHFFFAOYSA-N |
| SMILES | C1CNC2=C(C1=O)C=CC(=C2)Cl.Cl |
Computed by PubChem (NCBI)