Products 33282-21-2
CAS 33282-21-2 appears in our catalog under these names: 5- p -Tolyl-isoxazole-3-carboxylic acid, 97%, 5-(p-Tolyl)isoxazole-3-carboxylic acid, 97%, 5-p-Tolyl-isoxazole-3-carboxylic acid, 97%. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 5g.
5-(4-methylphenyl)-1,2-oxazole-3-carboxylic acid (CAS 33282-21-2) is a chemical compound with the molecular formula C11H9NO3 and a molecular weight of 203.19 g/mol. IUPAC name: 5-(4-methylphenyl)-1,2-oxazole-3-carboxylic acid. InChIKey: DDCNRVJWVNUYDO-UHFFFAOYSA-N.
| Molecular formula | C11H9NO3 |
|---|---|
| Molecular weight | 203.19 g/mol |
| IUPAC name | 5-(4-methylphenyl)-1,2-oxazole-3-carboxylic acid |
| InChIKey | DDCNRVJWVNUYDO-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC(=NO2)C(=O)O |
Computed by PubChem (NCBI)