Products 332849-40-8
CAS 332849-40-8 appears in our catalog under these names: N–(2–Benzo(1，3)dioxol–5–yl–ethyl)–2–(4–methyl–benzyl)–succinamic acid, antifungal-agent-6/ 98.47% (existing batch purity), Antifungal agent 6, 4-((2-(Benzo[d][1,3]dioxol-5-yl)ethyl)amino)-2-(4-methylbenzyl)-4-oxobutanoic acid, IDO1-IN-26, 98.22%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 25mg, 5mg, 1mg, 10mg, 50mg, 100mg, 200mg, 50 mg.
4-[2-(1,3-benzodioxol-5-yl)ethylamino]-2-[(4-methylphenyl)methyl]-4-oxobutanoic acid (CAS 332849-40-8) is a chemical compound with the molecular formula C21H23NO5 and a molecular weight of 369.4 g/mol. IUPAC name: 4-[2-(1,3-benzodioxol-5-yl)ethylamino]-2-[(4-methylphenyl)methyl]-4-oxobutanoic acid. InChIKey: WFDVRQOVLBEPIS-UHFFFAOYSA-N.
| Molecular formula | C21H23NO5 |
|---|---|
| Molecular weight | 369.4 g/mol |
| IUPAC name | 4-[2-(1,3-benzodioxol-5-yl)ethylamino]-2-[(4-methylphenyl)methyl]-4-oxobutanoic acid |
| InChIKey | WFDVRQOVLBEPIS-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CC(CC(=O)NCCC2=CC3=C(C=C2)OCO3)C(=O)O |
Computed by PubChem (NCBI)