CAS 332929-55-2 is the registry number for 5-Bromo-1-butyl-1h-indole-2,3-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
5-bromo-1-butylindole-2,3-dione (CAS 332929-55-2) is a chemical compound with the molecular formula C12H12BrNO2 and a molecular weight of 282.13 g/mol. IUPAC name: 5-bromo-1-butylindole-2,3-dione. InChIKey: OQHCOYLIOZLIKI-UHFFFAOYSA-N.
| Molecular formula | C12H12BrNO2 |
|---|---|
| Molecular weight | 282.13 g/mol |
| IUPAC name | 5-bromo-1-butylindole-2,3-dione |
| InChIKey | OQHCOYLIOZLIKI-UHFFFAOYSA-N |
| SMILES | CCCCN1C2=C(C=C(C=C2)Br)C(=O)C1=O |
Computed by PubChem (NCBI)