Products 33295-56-6

CAS 33295-56-6 is the registry number for METHYL 3-METHOXY-1-NAPHTHOATE, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

Methyl 3-methoxynaphthalene-1-carboxylate (CAS 33295-56-6) is a chemical compound with the molecular formula C13H12O3 and a molecular weight of 216.23 g/mol. IUPAC name: methyl 3-methoxynaphthalene-1-carboxylate. InChIKey: BEBCQOOSNKBJHU-UHFFFAOYSA-N.

Identity
Molecular formulaC13H12O3
Molecular weight216.23 g/mol
IUPAC namemethyl 3-methoxynaphthalene-1-carboxylate
InChIKeyBEBCQOOSNKBJHU-UHFFFAOYSA-N
SMILESCOC1=CC2=CC=CC=C2C(=C1)C(=O)OC

Computed by PubChem (NCBI)