Products 3333-15-1
CAS 3333-15-1 appears in our catalog under these names: 2,3-Diphenylpropionic acid, 98%, 2，3–Diphenylpropionic Acid, 2,3-Diphenylpropionic Acid, >98.0%(GC)(T), 2,3-Diphenylpropanoic acid 98%, 2,3-Diphenylpropanoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 25g, 1g, 5g, 10g, 100g, 500g, 250mg.
2,3-diphenylpropanoic acid (CAS 3333-15-1) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 2,3-diphenylpropanoic acid. InChIKey: PCRICPYPVZKEBZ-UHFFFAOYSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2,3-diphenylpropanoic acid |
| InChIKey | PCRICPYPVZKEBZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C2=CC=CC=C2)C(=O)O |
Computed by PubChem (NCBI)