CAS 333320-52-8 is the registry number for N-(2,5-Dimethylphenyl)-n-[(4-methylphenyl)sulfonyl]glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-(2,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetic acid (CAS 333320-52-8) is a chemical compound with the molecular formula C17H19NO4S and a molecular weight of 333.4 g/mol. IUPAC name: 2-(2,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetic acid. InChIKey: SAUMSIVCTGTZKK-UHFFFAOYSA-N.
| Molecular formula | C17H19NO4S |
|---|---|
| Molecular weight | 333.4 g/mol |
| IUPAC name | 2-(2,5-dimethyl-N-(4-methylphenyl)sulfonylanilino)acetic acid |
| InChIKey | SAUMSIVCTGTZKK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=C(C=CC(=C2)C)C |
Computed by PubChem (NCBI)