CAS 33333-95-8 is the registry number for N,N-Dimethyl-1H-indol-2-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
N,N-dimethyl-1H-indol-2-amine;hydrochloride (CAS 33333-95-8) is a chemical compound with the molecular formula C10H13ClN2 and a molecular weight of 196.67 g/mol. IUPAC name: N,N-dimethyl-1H-indol-2-amine;hydrochloride. InChIKey: SINMVXNOCNFHNL-UHFFFAOYSA-N.
| Molecular formula | C10H13ClN2 |
|---|---|
| Molecular weight | 196.67 g/mol |
| IUPAC name | N,N-dimethyl-1H-indol-2-amine;hydrochloride |
| InChIKey | SINMVXNOCNFHNL-UHFFFAOYSA-N |
| SMILES | CN(C)C1=CC2=CC=CC=C2N1.Cl |
Computed by PubChem (NCBI)