CAS 33367-55-4 appears in our catalog under these names: Diethyl 2,3-Diisopropylsuccinate, Diethyl 2,3-diisopropylsuccinate 98%, Diethyl 2,3-diisopropylsuccinate, 95%, 95%, Diethyl 2,3-diisopropylsuccinate, 95%. Offered by: Chemat Brand, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: on request, 1000mg, 100mg, 250mg, 1g, 5g, 10g, 25g.
Diethyl 2,3-di(propan-2-yl)butanedioate (CAS 33367-55-4) is a chemical compound with the molecular formula C14H26O4 and a molecular weight of 258.35 g/mol. IUPAC name: diethyl 2,3-di(propan-2-yl)butanedioate. InChIKey: WGFNXLQURMLAGC-UHFFFAOYSA-N.
| Molecular formula | C14H26O4 |
|---|---|
| Molecular weight | 258.35 g/mol |
| IUPAC name | diethyl 2,3-di(propan-2-yl)butanedioate |
| InChIKey | WGFNXLQURMLAGC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(C)C)C(C(C)C)C(=O)OCC |
Computed by PubChem (NCBI)