CAS 333794-18-6 is the registry number for Benzyl 3-Methyl-2-nitrobenzoate. Offered by: TRC. Available pack sizes: 2,5g.
Benzyl 3-methyl-2-nitrobenzoate (CAS 333794-18-6) is a chemical compound with the molecular formula C15H13NO4 and a molecular weight of 271.27 g/mol. IUPAC name: benzyl 3-methyl-2-nitrobenzoate. InChIKey: ARHAOJCHDARTQA-UHFFFAOYSA-N.
| Molecular formula | C15H13NO4 |
|---|---|
| Molecular weight | 271.27 g/mol |
| IUPAC name | benzyl 3-methyl-2-nitrobenzoate |
| InChIKey | ARHAOJCHDARTQA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C(=O)OCC2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)