Products 334017-23-1
CAS 334017-23-1 appears in our catalog under these names: 1-Methyl-3-(pyridin-2-yl)-1h-pyrazole-5-carboxylic acid, 95%, 1-Methyl-3-(pyridin-2-yl)-1H-pyrazole-5-carboxylic acid, 97%, 1-Methyl-3-(pyridin-2-yl)-1H-pyrazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 0,5g, 50mg.
1-methyl-3-pyridin-2-ylpyrazole-5-carboxylic acid (CAS 334017-23-1) is a chemical compound with the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. IUPAC name: 1-methyl-3-pyridin-2-ylpyrazole-5-carboxylic acid. InChIKey: PQSQNZNTVNGSAE-UHFFFAOYSA-N.
| Molecular formula | C10H9N3O2 |
|---|---|
| Molecular weight | 203.20 g/mol |
| IUPAC name | 1-methyl-3-pyridin-2-ylpyrazole-5-carboxylic acid |
| InChIKey | PQSQNZNTVNGSAE-UHFFFAOYSA-N |
| SMILES | CN1C(=CC(=N1)C2=CC=CC=N2)C(=O)O |
Computed by PubChem (NCBI)