CAS 33421-39-5 appears in our catalog under these names: 2-Phenylnicotinic acid, 97%, 2-Phenylnicotinic Acid, >95% (HPLC), 2–Phenylpyridine–3–carboxylic Acid, 2-Phenylpyridine-3-carboxylic Acid, >98.0%(GC)(T), 2-Phenylnicotinic acid 97%. Offered by: Combi-blocks, TRC, GLPBio, TCI, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 500mg, 50mg, 5g, 200mg, 10g.
2-phenylpyridine-3-carboxylic acid (CAS 33421-39-5) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 2-phenylpyridine-3-carboxylic acid. InChIKey: VLQVAEFYIADOKI-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 2-phenylpyridine-3-carboxylic acid |
| InChIKey | VLQVAEFYIADOKI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(C=CC=N2)C(=O)O |
Computed by PubChem (NCBI)