CAS 33468-83-6 is the registry number for 4-(4-(Trifluoromethyl)-1H-imidazol-2-yl)pyridine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
4-[5-(trifluoromethyl)-1H-imidazol-2-yl]pyridine (CAS 33468-83-6) is a chemical compound with the molecular formula C9H6F3N3 and a molecular weight of 213.16 g/mol. IUPAC name: 4-[5-(trifluoromethyl)-1H-imidazol-2-yl]pyridine. InChIKey: FUQVCTWCKFGEPE-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3 |
|---|---|
| Molecular weight | 213.16 g/mol |
| IUPAC name | 4-[5-(trifluoromethyl)-1H-imidazol-2-yl]pyridine |
| InChIKey | FUQVCTWCKFGEPE-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1C2=NC=C(N2)C(F)(F)F |
Computed by PubChem (NCBI)