CAS 335081-05-5 is the registry number for 2,4'-Dibromoacetophenone-2-13C, 99 atom % 13C, min 98% Chemical Purity. Offered by: CDN. Available pack sizes: 0,1g.
2-bromo-1-(4-bromophenyl)(213C)ethanone (CAS 335081-05-5) is a chemical compound with the molecular formula C8H6Br2O and a molecular weight of 278.93 g/mol. IUPAC name: 2-bromo-1-(4-bromophenyl)(213C)ethanone. InChIKey: FKJSFKCZZIXQIP-HOSYLAQJSA-N.
| Molecular formula | C8H6Br2O |
|---|---|
| Molecular weight | 278.93 g/mol |
| IUPAC name | 2-bromo-1-(4-bromophenyl)(213C)ethanone |
| InChIKey | FKJSFKCZZIXQIP-HOSYLAQJSA-N |
| SMILES | C1=CC(=CC=C1C(=O)[13CH2]Br)Br |
Computed by PubChem (NCBI)