CAS 33522-15-5 is the registry number for 1-(1,3-Dioxaindan-5-yl)cyclopropane-1-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-(1,3-benzodioxol-5-yl)cyclopropane-1-carbaldehyde (CAS 33522-15-5) is a chemical compound with the molecular formula C11H10O3 and a molecular weight of 190.19 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)cyclopropane-1-carbaldehyde. InChIKey: HMUCNHQJQSOIQC-UHFFFAOYSA-N.
| Molecular formula | C11H10O3 |
|---|---|
| Molecular weight | 190.19 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)cyclopropane-1-carbaldehyde |
| InChIKey | HMUCNHQJQSOIQC-UHFFFAOYSA-N |
| SMILES | C1CC1(C=O)C2=CC3=C(C=C2)OCO3 |
Computed by PubChem (NCBI)