CAS 33522-63-3 appears in our catalog under these names: 2-Amino-3-(2H-1,3-benzodioxol-5-yl)propanoic acid, 95%, 2–Amino–3–(benzo(d)(1,3)dioxol–5–yl)propanoic acid, 2-Amino-3-(1,3-dioxaindan-5-yl)propanoic acid. Offered by: AmBeed, GLPBio, Biosynth. Available pack sizes: 1g, 100mg.
2-amino-3-(1,3-benzodioxol-5-yl)propanoic acid (CAS 33522-63-3) is a chemical compound with the molecular formula C10H11NO4 and a molecular weight of 209.20 g/mol. IUPAC name: 2-amino-3-(1,3-benzodioxol-5-yl)propanoic acid. InChIKey: XHBLRJRZRFZSGW-UHFFFAOYSA-N.
| Molecular formula | C10H11NO4 |
|---|---|
| Molecular weight | 209.20 g/mol |
| IUPAC name | 2-amino-3-(1,3-benzodioxol-5-yl)propanoic acid |
| InChIKey | XHBLRJRZRFZSGW-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C(C=C2)CC(C(=O)O)N |
Computed by PubChem (NCBI)