CAS 33662-26-9 appears in our catalog under these names: Boc–Thr–OBzl, Boc-Thr-OBzl, Boc-Thr-OBzl 98%, Boc-Thr-OBzl, 97%, 97%, Boc-Thr-OBzl, 97%. Offered by: GLPBio, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 10g, 50g, 1g, 100g, 500g.
Benzyl (2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 33662-26-9) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: benzyl (2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: FHOGXXUNJQGWOP-YPMHNXCESA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | benzyl (2S,3R)-3-hydroxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | FHOGXXUNJQGWOP-YPMHNXCESA-N |
| SMILES | C[C@H]([C@@H](C(=O)OCC1=CC=CC=C1)NC(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)