CAS 337912-52-4 appears in our catalog under these names: N-(4-Aminophenyl)propane-1-sulfonamide, N-(4-Aminophenyl)propane-1-sulfonamide, 95%. Offered by: Biosynth, Combi-blocks. Available pack sizes: 5g, 0,5g, 10g, 1g, 250mg.
N-(4-aminophenyl)propane-1-sulfonamide (CAS 337912-52-4) is a chemical compound with the molecular formula C9H14N2O2S and a molecular weight of 214.29 g/mol. IUPAC name: N-(4-aminophenyl)propane-1-sulfonamide. InChIKey: DUUBLKMKQRMPKH-UHFFFAOYSA-N.
| Molecular formula | C9H14N2O2S |
|---|---|
| Molecular weight | 214.29 g/mol |
| IUPAC name | N-(4-aminophenyl)propane-1-sulfonamide |
| InChIKey | DUUBLKMKQRMPKH-UHFFFAOYSA-N |
| SMILES | CCCS(=O)(=O)NC1=CC=C(C=C1)N |
Computed by PubChem (NCBI)