Products 3380-53-8
CAS 3380-53-8 is the registry number for 5-Chloro-2-(4-chlorophenoxy)phenol 1-acetate. Offered by: Biosynth. Available pack sizes: 50mg, 100mg.
[5-chloro-2-(4-chlorophenoxy)phenyl] acetate (CAS 3380-53-8) is a chemical compound with the molecular formula C14H10Cl2O3 and a molecular weight of 297.1 g/mol. IUPAC name: [5-chloro-2-(4-chlorophenoxy)phenyl] acetate. InChIKey: YTAZWFNGRUOZDF-UHFFFAOYSA-N.
| Molecular formula | C14H10Cl2O3 |
|---|---|
| Molecular weight | 297.1 g/mol |
| IUPAC name | [5-chloro-2-(4-chlorophenoxy)phenyl] acetate |
| InChIKey | YTAZWFNGRUOZDF-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=C(C=CC(=C1)Cl)OC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)