CAS 33828-92-1 is the registry number for 1–(6–hydroxy–2–naphthyl)–propan–1–one. Offered by: GLPBio. Available pack sizes: 1g, 5g.
1-(6-hydroxynaphthalen-2-yl)propan-1-one (CAS 33828-92-1) is a chemical compound with the molecular formula C13H12O2 and a molecular weight of 200.23 g/mol. IUPAC name: 1-(6-hydroxynaphthalen-2-yl)propan-1-one. InChIKey: YIRMOLBYIHACJF-UHFFFAOYSA-N.
| Molecular formula | C13H12O2 |
|---|---|
| Molecular weight | 200.23 g/mol |
| IUPAC name | 1-(6-hydroxynaphthalen-2-yl)propan-1-one |
| InChIKey | YIRMOLBYIHACJF-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC2=C(C=C1)C=C(C=C2)O |
Computed by PubChem (NCBI)