CAS 33866-48-7 appears in our catalog under these names: 5–Amino–3–(4–chlorophenyl)isoxazole, 3-(4-CHLOROPHENYL)ISOXAZOL-5-AMINE, 98%. Offered by: GLPBio, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg.
3-(4-chlorophenyl)-1,2-oxazol-5-amine (CAS 33866-48-7) is a chemical compound with the molecular formula C9H7ClN2O and a molecular weight of 194.62 g/mol. IUPAC name: 3-(4-chlorophenyl)-1,2-oxazol-5-amine. InChIKey: KRQFEURBUJROHA-UHFFFAOYSA-N.
| Molecular formula | C9H7ClN2O |
|---|---|
| Molecular weight | 194.62 g/mol |
| IUPAC name | 3-(4-chlorophenyl)-1,2-oxazol-5-amine |
| InChIKey | KRQFEURBUJROHA-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NOC(=C2)N)Cl |
Computed by PubChem (NCBI)