Products 338792-43-1

CAS 338792-43-1 is the registry number for Methyl 2,2-difluoro-2-(4-fluorophenoxy)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2,2-difluoro-2-(4-fluorophenoxy)acetate (CAS 338792-43-1) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: methyl 2,2-difluoro-2-(4-fluorophenoxy)acetate. InChIKey: IWVCBDBBZZFEEW-UHFFFAOYSA-N.

Identity
Molecular formulaC9H7F3O3
Molecular weight220.14 g/mol
IUPAC namemethyl 2,2-difluoro-2-(4-fluorophenoxy)acetate
InChIKeyIWVCBDBBZZFEEW-UHFFFAOYSA-N
SMILESCOC(=O)C(OC1=CC=C(C=C1)F)(F)F

Computed by PubChem (NCBI)