CAS 338792-43-1 is the registry number for Methyl 2,2-difluoro-2-(4-fluorophenoxy)acetate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
Methyl 2,2-difluoro-2-(4-fluorophenoxy)acetate (CAS 338792-43-1) is a chemical compound with the molecular formula C9H7F3O3 and a molecular weight of 220.14 g/mol. IUPAC name: methyl 2,2-difluoro-2-(4-fluorophenoxy)acetate. InChIKey: IWVCBDBBZZFEEW-UHFFFAOYSA-N.
| Molecular formula | C9H7F3O3 |
|---|---|
| Molecular weight | 220.14 g/mol |
| IUPAC name | methyl 2,2-difluoro-2-(4-fluorophenoxy)acetate |
| InChIKey | IWVCBDBBZZFEEW-UHFFFAOYSA-N |
| SMILES | COC(=O)C(OC1=CC=C(C=C1)F)(F)F |
Computed by PubChem (NCBI)