Products 33886-52-1
CAS 33886-52-1 is the registry number for 6-Methoxy-2-phenylisoindolin-1-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 1g, 2,5g, 5g, 10g, 25g.
6-methoxy-2-phenyl-3H-isoindol-1-one (CAS 33886-52-1) is a chemical compound with the molecular formula C15H13NO2 and a molecular weight of 239.27 g/mol. IUPAC name: 6-methoxy-2-phenyl-3H-isoindol-1-one. InChIKey: KNCKXHMWOVZIGD-UHFFFAOYSA-N.
| Molecular formula | C15H13NO2 |
|---|---|
| Molecular weight | 239.27 g/mol |
| IUPAC name | 6-methoxy-2-phenyl-3H-isoindol-1-one |
| InChIKey | KNCKXHMWOVZIGD-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(CN(C2=O)C3=CC=CC=C3)C=C1 |
Computed by PubChem (NCBI)