CAS 3389-21-7 appears in our catalog under these names: Indolyl-3-(ethyl-Beta-bromide), 3-(2-Bromoethyl)indole, Indoramin EP Impurity A, 3–(2–Bromoethyl)indole, 3-(2-Bromoethyl)indole, 95%. Offered by: TRC, Mikromol, GLPBio, Thermo Scientific (Acros), TCI. Available pack sizes: 1g, 500mg, 5g, 4x25mg, 25mg, 250mg, 25g, 100mg.
3-(2-bromoethyl)-1H-indole (CAS 3389-21-7) is a chemical compound with the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. IUPAC name: 3-(2-bromoethyl)-1H-indole. InChIKey: NTLAICDKHHQUGC-UHFFFAOYSA-N.
| Molecular formula | C10H10BrN |
|---|---|
| Molecular weight | 224.10 g/mol |
| IUPAC name | 3-(2-bromoethyl)-1H-indole |
| InChIKey | NTLAICDKHHQUGC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)CCBr |
Computed by PubChem (NCBI)