CAS 338966-00-0 is the registry number for 2-(Chloromethyl)-3-(3,5-dimethylphenyl)-4(3H)-quinazolinone. Offered by: Biosynth. Available pack sizes: 1000mg.
2-(chloromethyl)-3-(3,5-dimethylphenyl)quinazolin-4-one (CAS 338966-00-0) is a chemical compound with the molecular formula C17H15ClN2O and a molecular weight of 298.8 g/mol. IUPAC name: 2-(chloromethyl)-3-(3,5-dimethylphenyl)quinazolin-4-one. InChIKey: GXARPXKXAUAAOE-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O |
|---|---|
| Molecular weight | 298.8 g/mol |
| IUPAC name | 2-(chloromethyl)-3-(3,5-dimethylphenyl)quinazolin-4-one |
| InChIKey | GXARPXKXAUAAOE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)N2C(=NC3=CC=CC=C3C2=O)CCl)C |
Computed by PubChem (NCBI)