CAS 36951-86-7 is the registry number for Homomazindol. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10000mg, 5000mg.
6-(4-chlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-b]isoindol-6-ol (CAS 36951-86-7) is a chemical compound with the molecular formula C17H15ClN2O and a molecular weight of 298.8 g/mol. IUPAC name: 6-(4-chlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-b]isoindol-6-ol. InChIKey: ZGLAJTSGABGHND-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O |
|---|---|
| Molecular weight | 298.8 g/mol |
| IUPAC name | 6-(4-chlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-b]isoindol-6-ol |
| InChIKey | ZGLAJTSGABGHND-UHFFFAOYSA-N |
| SMILES | C1CN=C2C3=CC=CC=C3C(N2C1)(C4=CC=C(C=C4)Cl)O |
Computed by PubChem (NCBI)