CAS 37751-39-6 is the registry number for Ciclazindol. Offered by: MedChemExpress. Available pack sizes: Get quote.
10-(3-chlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol (CAS 37751-39-6) is a chemical compound with the molecular formula C17H15ClN2O and a molecular weight of 298.8 g/mol. IUPAC name: 10-(3-chlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol. InChIKey: VKQDZNZTPGLGFD-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O |
|---|---|
| Molecular weight | 298.8 g/mol |
| IUPAC name | 10-(3-chlorophenyl)-3,4-dihydro-2H-pyrimido[1,2-a]indol-10-ol |
| InChIKey | VKQDZNZTPGLGFD-UHFFFAOYSA-N |
| SMILES | C1CN=C2C(C3=CC=CC=C3N2C1)(C4=CC(=CC=C4)Cl)O |
Computed by PubChem (NCBI)