CAS 371244-11-0 is the registry number for 2-(Chloromethyl)-5-methyl-3-(o-tolyl)quinazolin-4(3H)-one. Offered by: Biosynth, Chemat. Available pack sizes: 500mg, 1000mg, 1g.
2-(chloromethyl)-5-methyl-3-(2-methylphenyl)quinazolin-4-one (CAS 371244-11-0) is a chemical compound with the molecular formula C17H15ClN2O and a molecular weight of 298.8 g/mol. IUPAC name: 2-(chloromethyl)-5-methyl-3-(2-methylphenyl)quinazolin-4-one. InChIKey: ZOTCSPSVHIKHBZ-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O |
|---|---|
| Molecular weight | 298.8 g/mol |
| IUPAC name | 2-(chloromethyl)-5-methyl-3-(2-methylphenyl)quinazolin-4-one |
| InChIKey | ZOTCSPSVHIKHBZ-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)N=C(N(C2=O)C3=CC=CC=C3C)CCl |
Computed by PubChem (NCBI)