Products 5571-65-3

CAS 5571-65-3 is the registry number for N-Desmethyl-N-ethyl Diazepam. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 5mg, 2mg, 10mg, 25mg, 50mg.

Structural formula: {0} (CAS {1})

7-chloro-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one (CAS 5571-65-3) is a chemical compound with the molecular formula C17H15ClN2O and a molecular weight of 298.8 g/mol. IUPAC name: 7-chloro-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one. InChIKey: PMOYAPWQLZTKJB-UHFFFAOYSA-N.

Identity
Molecular formulaC17H15ClN2O
Molecular weight298.8 g/mol
IUPAC name7-chloro-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one
InChIKeyPMOYAPWQLZTKJB-UHFFFAOYSA-N
SMILESCCN1C(=O)CN=C(C2=C1C=CC(=C2)Cl)C3=CC=CC=C3

Computed by PubChem (NCBI)