CAS 5571-65-3 is the registry number for N-Desmethyl-N-ethyl Diazepam. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 5mg, 2mg, 10mg, 25mg, 50mg.
7-chloro-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one (CAS 5571-65-3) is a chemical compound with the molecular formula C17H15ClN2O and a molecular weight of 298.8 g/mol. IUPAC name: 7-chloro-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one. InChIKey: PMOYAPWQLZTKJB-UHFFFAOYSA-N.
| Molecular formula | C17H15ClN2O |
|---|---|
| Molecular weight | 298.8 g/mol |
| IUPAC name | 7-chloro-1-ethyl-5-phenyl-3H-1,4-benzodiazepin-2-one |
| InChIKey | PMOYAPWQLZTKJB-UHFFFAOYSA-N |
| SMILES | CCN1C(=O)CN=C(C2=C1C=CC(=C2)Cl)C3=CC=CC=C3 |
Computed by PubChem (NCBI)