CAS 3391-75-1 appears in our catalog under these names: 4-Hydroxy-3-methoxystilbene, 95%, 4-Hydroxy-3-methoxystilbene. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g.
2-methoxy-4-[(E)-2-phenylethenyl]phenol (CAS 3391-75-1) is a chemical compound with the molecular formula C15H14O2 and a molecular weight of 226.27 g/mol. IUPAC name: 2-methoxy-4-[(E)-2-phenylethenyl]phenol. InChIKey: NGWKZKAEKABLFG-BQYQJAHWSA-N.
| Molecular formula | C15H14O2 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | 2-methoxy-4-[(E)-2-phenylethenyl]phenol |
| InChIKey | NGWKZKAEKABLFG-BQYQJAHWSA-N |
| SMILES | COC1=C(C=CC(=C1)/C=C/C2=CC=CC=C2)O |
Computed by PubChem (NCBI)