Products 34006-76-3

CAS 34006-76-3 is the registry number for DMEP. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-O-butyl 1-O-methyl benzene-1,2-dicarboxylate (CAS 34006-76-3) is a chemical compound with the molecular formula C13H16O4 and a molecular weight of 236.26 g/mol. IUPAC name: 2-O-butyl 1-O-methyl benzene-1,2-dicarboxylate. InChIKey: XXFSYINDUHLBIL-UHFFFAOYSA-N.

Identity
Molecular formulaC13H16O4
Molecular weight236.26 g/mol
IUPAC name2-O-butyl 1-O-methyl benzene-1,2-dicarboxylate
InChIKeyXXFSYINDUHLBIL-UHFFFAOYSA-N
SMILESCCCCOC(=O)C1=CC=CC=C1C(=O)OC

Computed by PubChem (NCBI)