CAS 341006-48-2 is the registry number for Methyl 3,5-dimethyl-4-(((trifluoromethyl)sulfonyl)oxy)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Methyl 3,5-dimethyl-4-(trifluoromethylsulfonyloxy)benzoate (CAS 341006-48-2) is a chemical compound with the molecular formula C11H11F3O5S and a molecular weight of 312.26 g/mol. IUPAC name: methyl 3,5-dimethyl-4-(trifluoromethylsulfonyloxy)benzoate. InChIKey: LDBAVJDFQNAEKO-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O5S |
|---|---|
| Molecular weight | 312.26 g/mol |
| IUPAC name | methyl 3,5-dimethyl-4-(trifluoromethylsulfonyloxy)benzoate |
| InChIKey | LDBAVJDFQNAEKO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1OS(=O)(=O)C(F)(F)F)C)C(=O)OC |
Computed by PubChem (NCBI)