CAS 712223-57-9 is the registry number for 4-(2-Acetoxyethyl)phenol Trifluoromethanesulfonate. Offered by: TRC. Available pack sizes: 500mg, 50mg.
2-[4-(trifluoromethylsulfonyloxy)phenyl]ethyl acetate (CAS 712223-57-9) is a chemical compound with the molecular formula C11H11F3O5S and a molecular weight of 312.26 g/mol. IUPAC name: 2-[4-(trifluoromethylsulfonyloxy)phenyl]ethyl acetate. InChIKey: KQWGBWPGLDKICK-UHFFFAOYSA-N.
| Molecular formula | C11H11F3O5S |
|---|---|
| Molecular weight | 312.26 g/mol |
| IUPAC name | 2-[4-(trifluoromethylsulfonyloxy)phenyl]ethyl acetate |
| InChIKey | KQWGBWPGLDKICK-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCC1=CC=C(C=C1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)