Products 712223-57-9

CAS 712223-57-9 is the registry number for 4-(2-Acetoxyethyl)phenol Trifluoromethanesulfonate. Offered by: TRC. Available pack sizes: 500mg, 50mg.

Structural formula: {0} (CAS {1})

2-[4-(trifluoromethylsulfonyloxy)phenyl]ethyl acetate (CAS 712223-57-9) is a chemical compound with the molecular formula C11H11F3O5S and a molecular weight of 312.26 g/mol. IUPAC name: 2-[4-(trifluoromethylsulfonyloxy)phenyl]ethyl acetate. InChIKey: KQWGBWPGLDKICK-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11F3O5S
Molecular weight312.26 g/mol
IUPAC name2-[4-(trifluoromethylsulfonyloxy)phenyl]ethyl acetate
InChIKeyKQWGBWPGLDKICK-UHFFFAOYSA-N
SMILESCC(=O)OCCC1=CC=C(C=C1)OS(=O)(=O)C(F)(F)F

Computed by PubChem (NCBI)