CAS 845616-83-3 appears in our catalog under these names: 5-Methylsulfonyl-2-(((R)-2,2,2-trifluoro-1-methylethyl)oxy)benzoic acid, 97%, 5-(Methylsulfonyl)-2-[(1R)-2,2,2-trifluoro-1-methylethoxy]benzoic acid, 95%, 95%, 5-Methylsulfonyl-2-[((R)-2,2,2-trifluoro-1-methylethyl)oxy]benzoic acid, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 100mg, 25mg, 50mg.
5-methylsulfonyl-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxybenzoic acid (CAS 845616-83-3) is a chemical compound with the molecular formula C11H11F3O5S and a molecular weight of 312.26 g/mol. IUPAC name: 5-methylsulfonyl-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxybenzoic acid. InChIKey: KAFINIUNMPCGFL-ZCFIWIBFSA-N.
| Molecular formula | C11H11F3O5S |
|---|---|
| Molecular weight | 312.26 g/mol |
| IUPAC name | 5-methylsulfonyl-2-[(2R)-1,1,1-trifluoropropan-2-yl]oxybenzoic acid |
| InChIKey | KAFINIUNMPCGFL-ZCFIWIBFSA-N |
| SMILES | C[C@H](C(F)(F)F)OC1=C(C=C(C=C1)S(=O)(=O)C)C(=O)O |
Computed by PubChem (NCBI)