Products 859828-49-2

CAS 859828-49-2 is the registry number for alpha-Methyl-3-(((trifluoromethyl)sulfonyl)oxy)-benzeneacetic Acid Methyl Ester. Offered by: TRC. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Methyl 2-[3-(trifluoromethylsulfonyloxy)phenyl]propanoate (CAS 859828-49-2) is a chemical compound with the molecular formula C11H11F3O5S and a molecular weight of 312.26 g/mol. IUPAC name: methyl 2-[3-(trifluoromethylsulfonyloxy)phenyl]propanoate. InChIKey: ZGMOQKZZPJSTIB-UHFFFAOYSA-N.

Identity
Molecular formulaC11H11F3O5S
Molecular weight312.26 g/mol
IUPAC namemethyl 2-[3-(trifluoromethylsulfonyloxy)phenyl]propanoate
InChIKeyZGMOQKZZPJSTIB-UHFFFAOYSA-N
SMILESCC(C1=CC(=CC=C1)OS(=O)(=O)C(F)(F)F)C(=O)OC

Computed by PubChem (NCBI)