CAS 93836-43-2 is the registry number for (R)-Benzyl 2-(Trifluoromethylsulfonyloxy)propionate. Offered by: TRC. Available pack sizes: 100mg.
Benzyl (2R)-2-(trifluoromethylsulfonyloxy)propanoate (CAS 93836-43-2) is a chemical compound with the molecular formula C11H11F3O5S and a molecular weight of 312.26 g/mol. IUPAC name: benzyl (2R)-2-(trifluoromethylsulfonyloxy)propanoate. InChIKey: OCZJJSVVVXDQQC-MRVPVSSYSA-N.
| Molecular formula | C11H11F3O5S |
|---|---|
| Molecular weight | 312.26 g/mol |
| IUPAC name | benzyl (2R)-2-(trifluoromethylsulfonyloxy)propanoate |
| InChIKey | OCZJJSVVVXDQQC-MRVPVSSYSA-N |
| SMILES | C[C@H](C(=O)OCC1=CC=CC=C1)OS(=O)(=O)C(F)(F)F |
Computed by PubChem (NCBI)