CAS 3419-49-6 is the registry number for 4-Amino-3-methylbiphenyl Hydrochloride. Offered by: TRC. Available pack sizes: 100mg, 1g.
2-methyl-4-phenylaniline;hydrochloride (CAS 3419-49-6) is a chemical compound with the molecular formula C13H14ClN and a molecular weight of 219.71 g/mol. IUPAC name: 2-methyl-4-phenylaniline;hydrochloride. InChIKey: XMPYXYUWGANKMC-UHFFFAOYSA-N.
| Molecular formula | C13H14ClN |
|---|---|
| Molecular weight | 219.71 g/mol |
| IUPAC name | 2-methyl-4-phenylaniline;hydrochloride |
| InChIKey | XMPYXYUWGANKMC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)C2=CC=CC=C2)N.Cl |
Computed by PubChem (NCBI)