CAS 342002-82-8 appears in our catalog under these names: 4-(Isopropoxycarbonyl)phenylboronic Acid (contains varying amounts of Anhydride), (4-(Isopropoxycarbonyl)phenyl)boronic acid, 98%, 98%, 4-(iso-Propoxycarbonyl)phenylboronic acid, 98%, (4-(Isopropoxycarbonyl)phenyl)boronic acid, 98%. Offered by: TCI, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 25g, 100g.
(4-propan-2-yloxycarbonylphenyl)boronic acid (CAS 342002-82-8) is a chemical compound with the molecular formula C10H13BO4 and a molecular weight of 208.02 g/mol. IUPAC name: (4-propan-2-yloxycarbonylphenyl)boronic acid. InChIKey: NIQHFKWRHJZMQU-UHFFFAOYSA-N.
| Molecular formula | C10H13BO4 |
|---|---|
| Molecular weight | 208.02 g/mol |
| IUPAC name | (4-propan-2-yloxycarbonylphenyl)boronic acid |
| InChIKey | NIQHFKWRHJZMQU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)OC(C)C)(O)O |
Computed by PubChem (NCBI)