Products 34250-66-3

CAS 34250-66-3 appears in our catalog under these names: 2,1-Benzothiazole-3-carboxylic acid, Benzo(c)isothiazole-3-carboxylic acid, 97%. Offered by: Biosynth, AmBeed. Available pack sizes: 0,5g, 50mg, 1g.

2,1-benzothiazole-3-carboxylic acid (CAS 34250-66-3) is a chemical compound with the molecular formula C8H5NO2S and a molecular weight of 179.20 g/mol. IUPAC name: 2,1-benzothiazole-3-carboxylic acid. InChIKey: JYSZCXJYVNFLQZ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H5NO2S
Molecular weight179.20 g/mol
IUPAC name2,1-benzothiazole-3-carboxylic acid
InChIKeyJYSZCXJYVNFLQZ-UHFFFAOYSA-N
SMILESC1=CC2=C(SN=C2C=C1)C(=O)O

Computed by PubChem (NCBI)