CAS 34260-72-5 appears in our catalog under these names: (S)-Methyl 2-Amino-3-(3-hydroxyphenyl)propanoate Hydrochloride, (S)–Methyl 2–amino–3–(3–hydroxyphenyl)propanoate hydrochloride, (S)-Methyl 2-amino-3-(3-hydroxyphenyl)propanoate hydrochloride, 98%, 98%, (S)-Methyl 2-amino-3-(3-hydroxyphenyl)propanoate hydrochloride, 99.82%, (S)-Methyl 2-amino-3-(3-hydroxyphenyl)propanoate hydrochloride, 95%. Offered by: TRC, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 500mg, 1g, 10g, 5g, 100mg, 250mg, 25g, 25 g.
Methyl (2S)-2-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride (CAS 34260-72-5) is a chemical compound with the molecular formula C10H14ClNO3 and a molecular weight of 231.67 g/mol. IUPAC name: methyl (2S)-2-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride. InChIKey: WULJQXTZWBDFSE-FVGYRXGTSA-N.
| Molecular formula | C10H14ClNO3 |
|---|---|
| Molecular weight | 231.67 g/mol |
| IUPAC name | methyl (2S)-2-amino-3-(3-hydroxyphenyl)propanoate;hydrochloride |
| InChIKey | WULJQXTZWBDFSE-FVGYRXGTSA-N |
| SMILES | COC(=O)[C@H](CC1=CC(=CC=C1)O)N.Cl |
Computed by PubChem (NCBI)