CAS 34263-53-1 appears in our catalog under these names: 3-Chloro-4-sulfamoylbenzoic acid, 3-Chloro-4-sulfamoylbenzoic acid, 95%. Offered by: Biosynth, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 2.5g.
3-chloro-4-sulfamoylbenzoic acid (CAS 34263-53-1) is a chemical compound with the molecular formula C7H6ClNO4S and a molecular weight of 235.65 g/mol. IUPAC name: 3-chloro-4-sulfamoylbenzoic acid. InChIKey: VOISTTGQLIPIHV-UHFFFAOYSA-N.
| Molecular formula | C7H6ClNO4S |
|---|---|
| Molecular weight | 235.65 g/mol |
| IUPAC name | 3-chloro-4-sulfamoylbenzoic acid |
| InChIKey | VOISTTGQLIPIHV-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)Cl)S(=O)(=O)N |
Computed by PubChem (NCBI)